C26H26FN7O3 — CID 86290402
4-[4-[4-[[4-[3-(cyanomethyl)anilino]pyrimidin-2-yl]amino]-2-fluorophenyl]piperazin-1-yl]-4-oxobutanoic acid (PubChem CID 86290402) has the molecular formula C26H26FN7O3 and a molecular weight of 503.54 g/mol. Its IUPAC name is 4-[4-[4-[[4-[3-(cyanomethyl)anilino]pyrimidin-2-yl]amino]-2-fluorophenyl]piperazin-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[4-[4-[[4-[3-(cyanomethyl)anilino]pyrimidin-2-yl]amino]-2-fluorophenyl]piperazin-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 86290402 |
| Molecular Formula | C26H26FN7O3 |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 4-[4-[4-[[4-[3-(cyanomethyl)anilino]pyrimidin-2-yl]amino]-2-fluorophenyl]piperazin-1-yl]-4-oxobutanoic acid |
| SMILES | N#CCc1cccc(Nc2ccnc(Nc3ccc(N4CCN(C(=O)CCC(=O)O)CC4)c(F)c3)n2)c1 |
| InChI | InChI=1S/C26H26FN7O3/c27-21-17-20(4-5-22(21)33-12-14-34(15-13-33)24(35)6-7-25(36)37)31-26-29-11-9-23(32-26)30-19-3-1-2-18(16-19)8-10-28/h1-5,9,11,16-17H,6-8,12-15H2,(H,36,37)(H2,29,30,31,32) |
| InChIKey | YNGSPDVQYZFEKX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|