C23H26FN7O8S2 — CID 158760435
2-[3-[[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]acetonitrile;hydroperoxy hydroperoxysulfinyl sulfite (PubChem CID 158760435) has the molecular formula C23H26FN7O8S2 and a molecular weight of 611.63 g/mol. Its IUPAC name is 2-[3-[[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]acetonitrile;hydroperoxy hydroperoxysulfinyl sulfite.
| Compound Name | 2-[3-[[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]acetonitrile;hydroperoxy hydroperoxysulfinyl sulfite |
|---|---|
| PubChem CID | 158760435 |
| Molecular Formula | C23H26FN7O8S2 |
| Molecular Weight | 611.63 g/mol |
| Exact Mass | 611.13 |
| IUPAC Name | 2-[3-[[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]acetonitrile;hydroperoxy hydroperoxysulfinyl sulfite |
| SMILES | CN1CCN(c2ccc(Nc3nccc(Nc4cccc(CC#N)c4)n3)cc2F)CC1.O=S(OO)OS(=O)OOO |
| InChI | InChI=1S/C23H24FN7.H2O8S2/c1-30-11-13-31(14-12-30)21-6-5-19(16-20(21)24)28-23-26-10-8-22(29-23)27-18-4-2-3-17(15-18)7-9-25;1-5-7-10(4)8-9(3)6-2/h2-6,8,10,15-16H,7,11-14H2,1H3,(H2,26,27,28,29);1-2H |
| InChIKey | IOPCJVRPOLJPFZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 191.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|