C30H36N10O — CID 118420789
N-[3-[6-amino-2-[4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]purin-9-yl]phenyl]prop-2-enamide (PubChem CID 118420789) has the molecular formula C30H36N10O and a molecular weight of 552.69 g/mol. Its IUPAC name is N-[3-[6-amino-2-[4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]purin-9-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[6-amino-2-[4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]purin-9-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118420789 |
| Molecular Formula | C30H36N10O |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | N-[3-[6-amino-2-[4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]purin-9-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2cnc3c(N)nc(Nc4ccc(N5CCN(C6CCN(C)CC6)CC5)cc4)nc32)c1 |
| InChI | InChI=1S/C30H36N10O/c1-3-26(41)33-22-5-4-6-25(19-22)40-20-32-27-28(31)35-30(36-29(27)40)34-21-7-9-23(10-8-21)38-15-17-39(18-16-38)24-11-13-37(2)14-12-24/h3-10,19-20,24H,1,11-18H2,2H3,(H,33,41)(H3,31,34,35,36) |
| InChIKey | RNQAHBGPNGIYMJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|