C28H33N7O — CID 163216075
N-[3-[[4-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]prop-2-enamide (PubChem CID 163216075) has the molecular formula C28H33N7O and a molecular weight of 483.62 g/mol. Its IUPAC name is N-[3-[[4-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[4-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 163216075 |
| Molecular Formula | C28H33N7O |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | N-[3-[[4-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CN2CCc3c(C)nc(Nc4ccc(N5CCN(C)CC5)cc4)nc32)c1 |
| InChI | InChI=1S/C28H33N7O/c1-4-26(36)30-23-7-5-6-21(18-23)19-35-13-12-25-20(2)29-28(32-27(25)35)31-22-8-10-24(11-9-22)34-16-14-33(3)15-17-34/h4-11,18H,1,12-17,19H2,2-3H3,(H,30,36)(H,29,31,32) |
| InChIKey | KMVCVLAGAGCWTP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|