C26H27N7O — CID 122474344
N-[3-[7-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,5-c]pyrimidin-1-yl]phenyl]prop-2-enamide (PubChem CID 122474344) has the molecular formula C26H27N7O and a molecular weight of 453.55 g/mol. Its IUPAC name is N-[3-[7-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,5-c]pyrimidin-1-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[7-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,5-c]pyrimidin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122474344 |
| Molecular Formula | C26H27N7O |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | N-[3-[7-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,5-c]pyrimidin-1-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2ncn3cnc(Nc4ccc(N5CCN(C)CC5)cc4)cc23)c1 |
| InChI | InChI=1S/C26H27N7O/c1-3-25(34)30-21-6-4-5-19(15-21)26-23-16-24(27-17-33(23)18-28-26)29-20-7-9-22(10-8-20)32-13-11-31(2)12-14-32/h3-10,15-18,29H,1,11-14H2,2H3,(H,30,34) |
| InChIKey | ZKCBUZNVMKGUNQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|