C34H38N8O2 — CID 165398776
N-[3-[formyl-[5-[2-(N-methylanilino)ethyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 165398776) has the molecular formula C34H38N8O2 and a molecular weight of 590.73 g/mol. Its IUPAC name is N-[3-[formyl-[5-[2-(N-methylanilino)ethyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[formyl-[5-[2-(N-methylanilino)ethyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 165398776 |
| Molecular Formula | C34H38N8O2 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | N-[3-[formyl-[5-[2-(N-methylanilino)ethyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(N(C=O)c2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc2CCN(C)c2ccccc2)c1 |
| InChI | InChI=1S/C34H38N8O2/c1-4-32(44)36-28-9-8-12-31(23-28)42(25-43)33-26(17-18-40(3)29-10-6-5-7-11-29)24-35-34(38-33)37-27-13-15-30(16-14-27)41-21-19-39(2)20-22-41/h4-16,23-25H,1,17-22H2,2-3H3,(H,36,44)(H,35,37,38) |
| InChIKey | ACSBRRPIONLNEO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|