C35H31N7O2 — CID 118420566
N-[3-[6-(dibenzylamino)-2-(4-methoxyanilino)purin-9-yl]phenyl]prop-2-enamide (PubChem CID 118420566) has the molecular formula C35H31N7O2 and a molecular weight of 581.68 g/mol. Its IUPAC name is N-[3-[6-(dibenzylamino)-2-(4-methoxyanilino)purin-9-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[6-(dibenzylamino)-2-(4-methoxyanilino)purin-9-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118420566 |
| Molecular Formula | C35H31N7O2 |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | N-[3-[6-(dibenzylamino)-2-(4-methoxyanilino)purin-9-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2cnc3c(N(Cc4ccccc4)Cc4ccccc4)nc(Nc4ccc(OC)cc4)nc32)c1 |
| InChI | InChI=1S/C35H31N7O2/c1-3-31(43)37-28-15-10-16-29(21-28)42-24-36-32-33(39-35(40-34(32)42)38-27-17-19-30(44-2)20-18-27)41(22-25-11-6-4-7-12-25)23-26-13-8-5-9-14-26/h3-21,24H,1,22-23H2,2H3,(H,37,43)(H,38,39,40) |
| InChIKey | DFQYEZURCVPUAB-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|