C39H38N8O3 — CID 118426297
N-[3-[6-(dibenzylamino)-2-(3-methoxy-4-morpholin-4-ylanilino)purin-9-yl]phenyl]prop-2-enamide (PubChem CID 118426297) has the molecular formula C39H38N8O3 and a molecular weight of 666.79 g/mol. Its IUPAC name is N-[3-[6-(dibenzylamino)-2-(3-methoxy-4-morpholin-4-ylanilino)purin-9-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[6-(dibenzylamino)-2-(3-methoxy-4-morpholin-4-ylanilino)purin-9-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118426297 |
| Molecular Formula | C39H38N8O3 |
| Molecular Weight | 666.79 g/mol |
| Exact Mass | 666.31 |
| IUPAC Name | N-[3-[6-(dibenzylamino)-2-(3-methoxy-4-morpholin-4-ylanilino)purin-9-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2cnc3c(N(Cc4ccccc4)Cc4ccccc4)nc(Nc4ccc(N5CCOCC5)c(OC)c4)nc32)c1 |
| InChI | InChI=1S/C39H38N8O3/c1-3-35(48)41-30-15-10-16-32(23-30)47-27-40-36-37(46(25-28-11-6-4-7-12-28)26-29-13-8-5-9-14-29)43-39(44-38(36)47)42-31-17-18-33(34(24-31)49-2)45-19-21-50-22-20-45/h3-18,23-24,27H,1,19-22,25-26H2,2H3,(H,41,48)(H,42,43,44) |
| InChIKey | NBTWTJWIRPHOMI-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.79 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|