C38H37N7O3 — CID 118420692
(E)-N-[3-[6-(dibenzylamino)-2-[4-(2-methoxyethoxy)anilino]purin-9-yl]phenyl]but-2-enamide (PubChem CID 118420692) has the molecular formula C38H37N7O3 and a molecular weight of 639.76 g/mol. Its IUPAC name is (E)-N-[3-[6-(dibenzylamino)-2-[4-(2-methoxyethoxy)anilino]purin-9-yl]phenyl]but-2-enamide.
| Compound Name | (E)-N-[3-[6-(dibenzylamino)-2-[4-(2-methoxyethoxy)anilino]purin-9-yl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 118420692 |
| Molecular Formula | C38H37N7O3 |
| Molecular Weight | 639.76 g/mol |
| Exact Mass | 639.30 |
| IUPAC Name | (E)-N-[3-[6-(dibenzylamino)-2-[4-(2-methoxyethoxy)anilino]purin-9-yl]phenyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1cccc(-n2cnc3c(N(Cc4ccccc4)Cc4ccccc4)nc(Nc4ccc(OCCOC)cc4)nc32)c1 |
| InChI | InChI=1S/C38H37N7O3/c1-3-11-34(46)40-31-16-10-17-32(24-31)45-27-39-35-36(44(25-28-12-6-4-7-13-28)26-29-14-8-5-9-15-29)42-38(43-37(35)45)41-30-18-20-33(21-19-30)48-23-22-47-2/h3-21,24,27H,22-23,25-26H2,1-2H3,(H,40,46)(H,41,42,43)/b11-3+ |
| InChIKey | AUHAYHXTQGHKFT-QDEBKDIKSA-N |
| XLogP | 7.31 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.76 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|