C21H23N7O2 — CID 118421017
9-[(3-aminophenyl)methyl]-2-N-[4-(2-methoxyethoxy)phenyl]purine-2,6-diamine (PubChem CID 118421017) has the molecular formula C21H23N7O2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 9-[(3-aminophenyl)methyl]-2-N-[4-(2-methoxyethoxy)phenyl]purine-2,6-diamine.
| Compound Name | 9-[(3-aminophenyl)methyl]-2-N-[4-(2-methoxyethoxy)phenyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 118421017 |
| Molecular Formula | C21H23N7O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 9-[(3-aminophenyl)methyl]-2-N-[4-(2-methoxyethoxy)phenyl]purine-2,6-diamine |
| SMILES | COCCOc1ccc(Nc2nc(N)c3ncn(Cc4cccc(N)c4)c3n2)cc1 |
| InChI | InChI=1S/C21H23N7O2/c1-29-9-10-30-17-7-5-16(6-8-17)25-21-26-19(23)18-20(27-21)28(13-24-18)12-14-3-2-4-15(22)11-14/h2-8,11,13H,9-10,12,22H2,1H3,(H3,23,25,26,27) |
| InChIKey | JMJYEOGRFAQOHG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|