C20H24N8O2 — CID 118420552
(3S)-3-[6-amino-2-[4-(2-methoxyethoxy)anilino]purin-9-yl]piperidine-1-carbonitrile (PubChem CID 118420552) has the molecular formula C20H24N8O2 and a molecular weight of 408.47 g/mol. Its IUPAC name is (3S)-3-[6-amino-2-[4-(2-methoxyethoxy)anilino]purin-9-yl]piperidine-1-carbonitrile.
| Compound Name | (3S)-3-[6-amino-2-[4-(2-methoxyethoxy)anilino]purin-9-yl]piperidine-1-carbonitrile |
|---|---|
| PubChem CID | 118420552 |
| Molecular Formula | C20H24N8O2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (3S)-3-[6-amino-2-[4-(2-methoxyethoxy)anilino]purin-9-yl]piperidine-1-carbonitrile |
| SMILES | COCCOc1ccc(Nc2nc(N)c3ncn([C@H]4CCCN(C#N)C4)c3n2)cc1 |
| InChI | InChI=1S/C20H24N8O2/c1-29-9-10-30-16-6-4-14(5-7-16)24-20-25-18(22)17-19(26-20)28(13-23-17)15-3-2-8-27(11-15)12-21/h4-7,13,15H,2-3,8-11H2,1H3,(H3,22,24,25,26)/t15-/m0/s1 |
| InChIKey | ADKPRAMSDPXCHT-HNNXBMFYSA-N |
| XLogP | 2.30 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|