C38H48N12O4 — CID 160871672
methyl 2-[3-[[6-amino-2-(butylamino)purin-9-yl]methyl]phenyl]acetate (PubChem CID 160871672) has the molecular formula C38H48N12O4 and a molecular weight of 736.88 g/mol. Its IUPAC name is methyl 2-[3-[[6-amino-2-(butylamino)purin-9-yl]methyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[[6-amino-2-(butylamino)purin-9-yl]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 160871672 |
| Molecular Formula | C38H48N12O4 |
| Molecular Weight | 736.88 g/mol |
| Exact Mass | 736.39 |
| IUPAC Name | methyl 2-[3-[[6-amino-2-(butylamino)purin-9-yl]methyl]phenyl]acetate |
| SMILES | CCCCNc1nc(N)c2ncn(Cc3cccc(CC(=O)OC)c3)c2n1.CCCCNc1nc(N)c2ncn(Cc3cccc(CC(=O)OC)c3)c2n1 |
| InChI | InChI=1S/2C19H24N6O2/c2*1-3-4-8-21-19-23-17(20)16-18(24-19)25(12-22-16)11-14-7-5-6-13(9-14)10-15(26)27-2/h2*5-7,9,12H,3-4,8,10-11H2,1-2H3,(H3,20,21,23,24) |
| InChIKey | SLVMJRGIFILLDK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 215.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.88 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|