C18H21BrN6O2 — CID 160822756
methyl 2-[3-[6-amino-8-bromo-2-(butylamino)purin-9-yl]phenyl]acetate (PubChem CID 160822756) has the molecular formula C18H21BrN6O2 and a molecular weight of 433.31 g/mol. Its IUPAC name is methyl 2-[3-[6-amino-8-bromo-2-(butylamino)purin-9-yl]phenyl]acetate.
| Compound Name | methyl 2-[3-[6-amino-8-bromo-2-(butylamino)purin-9-yl]phenyl]acetate |
|---|---|
| PubChem CID | 160822756 |
| Molecular Formula | C18H21BrN6O2 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | methyl 2-[3-[6-amino-8-bromo-2-(butylamino)purin-9-yl]phenyl]acetate |
| SMILES | CCCCNc1nc(N)c2nc(Br)n(-c3cccc(CC(=O)OC)c3)c2n1 |
| InChI | InChI=1S/C18H21BrN6O2/c1-3-4-8-21-18-23-15(20)14-16(24-18)25(17(19)22-14)12-7-5-6-11(9-12)10-13(26)27-2/h5-7,9H,3-4,8,10H2,1-2H3,(H3,20,21,23,24) |
| InChIKey | XAGSBLXGXKKULM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|