C17H21BrN6O2 — CID 10216505
8-bromo-2-N-[2-(3,4-dimethoxyphenyl)ethyl]-9-ethylpurine-2,6-diamine (PubChem CID 10216505) has the molecular formula C17H21BrN6O2 and a molecular weight of 421.30 g/mol. Its IUPAC name is 8-bromo-2-N-[2-(3,4-dimethoxyphenyl)ethyl]-9-ethylpurine-2,6-diamine.
| Compound Name | 8-bromo-2-N-[2-(3,4-dimethoxyphenyl)ethyl]-9-ethylpurine-2,6-diamine |
|---|---|
| PubChem CID | 10216505 |
| Molecular Formula | C17H21BrN6O2 |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 8-bromo-2-N-[2-(3,4-dimethoxyphenyl)ethyl]-9-ethylpurine-2,6-diamine |
| SMILES | CCn1c(Br)nc2c(N)nc(NCCc3ccc(OC)c(OC)c3)nc21 |
| InChI | InChI=1S/C17H21BrN6O2/c1-4-24-15-13(21-16(24)18)14(19)22-17(23-15)20-8-7-10-5-6-11(25-2)12(9-10)26-3/h5-6,9H,4,7-8H2,1-3H3,(H3,19,20,22,23) |
| InChIKey | TUNGKLAAPDNREV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |