C22H25N7O — CID 138700814
9-benzyl-2-N-butyl-8-(5-methoxy-3-pyridinyl)purine-2,6-diamine (PubChem CID 138700814) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is 9-benzyl-2-N-butyl-8-(5-methoxy-3-pyridinyl)purine-2,6-diamine.
| Compound Name | 9-benzyl-2-N-butyl-8-(5-methoxy-3-pyridinyl)purine-2,6-diamine |
|---|---|
| PubChem CID | 138700814 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 9-benzyl-2-N-butyl-8-(5-methoxy-3-pyridinyl)purine-2,6-diamine |
| SMILES | CCCCNc1nc(N)c2nc(-c3cncc(OC)c3)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C22H25N7O/c1-3-4-10-25-22-27-19(23)18-21(28-22)29(14-15-8-6-5-7-9-15)20(26-18)16-11-17(30-2)13-24-12-16/h5-9,11-13H,3-4,10,14H2,1-2H3,(H3,23,25,27,28) |
| InChIKey | DCGPEOUYCAIZAL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|