C14H12ClN5O2 — CID 23158671
2-[3-[(6-amino-2-chloropurin-9-yl)methyl]phenyl]acetic acid (PubChem CID 23158671) has the molecular formula C14H12ClN5O2 and a molecular weight of 317.74 g/mol. Its IUPAC name is 2-[3-[(6-amino-2-chloropurin-9-yl)methyl]phenyl]acetic acid.
| Compound Name | 2-[3-[(6-amino-2-chloropurin-9-yl)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 23158671 |
| Molecular Formula | C14H12ClN5O2 |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-[3-[(6-amino-2-chloropurin-9-yl)methyl]phenyl]acetic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2Cc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C14H12ClN5O2/c15-14-18-12(16)11-13(19-14)20(7-17-11)6-9-3-1-2-8(4-9)5-10(21)22/h1-4,7H,5-6H2,(H,21,22)(H2,16,18,19) |
| InChIKey | IVAFQHRHBOWQEI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |