C6H7ClN6 — CID 156571755
9-(aminomethyl)-2-chloropurin-6-amine (PubChem CID 156571755) has the molecular formula C6H7ClN6 and a molecular weight of 198.62 g/mol. Its IUPAC name is 9-(aminomethyl)-2-chloropurin-6-amine.
| Compound Name | 9-(aminomethyl)-2-chloropurin-6-amine |
|---|---|
| PubChem CID | 156571755 |
| Molecular Formula | C6H7ClN6 |
| Molecular Weight | 198.62 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 9-(aminomethyl)-2-chloropurin-6-amine |
| SMILES | NCn1cnc2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C6H7ClN6/c7-6-11-4(9)3-5(12-6)13(1-8)2-10-3/h2H,1,8H2,(H2,9,11,12) |
| InChIKey | WARSKBMGDZILKN-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.62 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |