C10H10ClN5 — CID 134895588
2-chloro-9-(3-methylidenecyclobutyl)purin-6-amine (PubChem CID 134895588) has the molecular formula C10H10ClN5 and a molecular weight of 235.68 g/mol. Its IUPAC name is 2-chloro-9-(3-methylidenecyclobutyl)purin-6-amine.
| Compound Name | 2-chloro-9-(3-methylidenecyclobutyl)purin-6-amine |
|---|---|
| PubChem CID | 134895588 |
| Molecular Formula | C10H10ClN5 |
| Molecular Weight | 235.68 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-chloro-9-(3-methylidenecyclobutyl)purin-6-amine |
| SMILES | C=C1CC(n2cnc3c(N)nc(Cl)nc32)C1 |
| InChI | InChI=1S/C10H10ClN5/c1-5-2-6(3-5)16-4-13-7-8(12)14-10(11)15-9(7)16/h4,6H,1-3H2,(H2,12,14,15) |
| InChIKey | UUVFZCLVGTXVOE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.68 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|