C13H22ClN5O — CID 145388425
4-(6-amino-2-chloropurin-9-yl)-2-ethylbutan-1-ol;ethane (PubChem CID 145388425) has the molecular formula C13H22ClN5O and a molecular weight of 299.81 g/mol. Its IUPAC name is 4-(6-amino-2-chloropurin-9-yl)-2-ethylbutan-1-ol;ethane.
| Compound Name | 4-(6-amino-2-chloropurin-9-yl)-2-ethylbutan-1-ol;ethane |
|---|---|
| PubChem CID | 145388425 |
| Molecular Formula | C13H22ClN5O |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-(6-amino-2-chloropurin-9-yl)-2-ethylbutan-1-ol;ethane |
| SMILES | CC.CCC(CO)CCn1cnc2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C11H16ClN5O.C2H6/c1-2-7(5-18)3-4-17-6-14-8-9(13)15-11(12)16-10(8)17;1-2/h6-7,18H,2-5H2,1H3,(H2,13,15,16);1-2H3 |
| InChIKey | YFFDTPBIIBFQJA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |