C21H27ClF2N6O3 — CID 145395687
4-(6-amino-2-chloropurin-9-yl)butyl N-[(4-ethoxy-2,6-difluorophenyl)methyl]carbamate;ethane (PubChem CID 145395687) has the molecular formula C21H27ClF2N6O3 and a molecular weight of 484.94 g/mol. Its IUPAC name is 4-(6-amino-2-chloropurin-9-yl)butyl N-[(4-ethoxy-2,6-difluorophenyl)methyl]carbamate;ethane.
| Compound Name | 4-(6-amino-2-chloropurin-9-yl)butyl N-[(4-ethoxy-2,6-difluorophenyl)methyl]carbamate;ethane |
|---|---|
| PubChem CID | 145395687 |
| Molecular Formula | C21H27ClF2N6O3 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 4-(6-amino-2-chloropurin-9-yl)butyl N-[(4-ethoxy-2,6-difluorophenyl)methyl]carbamate;ethane |
| SMILES | CC.CCOc1cc(F)c(CNC(=O)OCCCCn2cnc3c(N)nc(Cl)nc32)c(F)c1 |
| InChI | InChI=1S/C19H21ClF2N6O3.C2H6/c1-2-30-11-7-13(21)12(14(22)8-11)9-24-19(29)31-6-4-3-5-28-10-25-15-16(23)26-18(20)27-17(15)28;1-2/h7-8,10H,2-6,9H2,1H3,(H,24,29)(H2,23,26,27);1-2H3 |
| InChIKey | MCWWQOUGRKGMJX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|