C18H16Cl3F3N6O2 — CID 138609682
4-(6-amino-2-chloropurin-9-yl)butyl N-[[2,6-dichloro-3-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 138609682) has the molecular formula C18H16Cl3F3N6O2 and a molecular weight of 511.72 g/mol. Its IUPAC name is 4-(6-amino-2-chloropurin-9-yl)butyl N-[[2,6-dichloro-3-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | 4-(6-amino-2-chloropurin-9-yl)butyl N-[[2,6-dichloro-3-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 138609682 |
| Molecular Formula | C18H16Cl3F3N6O2 |
| Molecular Weight | 511.72 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | 4-(6-amino-2-chloropurin-9-yl)butyl N-[[2,6-dichloro-3-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | Nc1nc(Cl)nc2c1ncn2CCCCOC(=O)NCc1c(Cl)ccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C18H16Cl3F3N6O2/c19-11-4-3-10(18(22,23)24)12(20)9(11)7-26-17(31)32-6-2-1-5-30-8-27-13-14(25)28-16(21)29-15(13)30/h3-4,8H,1-2,5-7H2,(H,26,31)(H2,25,28,29) |
| InChIKey | SAWCHZKHEBILLX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.72 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|