C20H24ClN7O4S — CID 138609662
4-(6-amino-2-chloropurin-9-yl)butyl N-[[4-(cyclopropylsulfonylamino)phenyl]methyl]carbamate (PubChem CID 138609662) has the molecular formula C20H24ClN7O4S and a molecular weight of 493.98 g/mol. Its IUPAC name is 4-(6-amino-2-chloropurin-9-yl)butyl N-[[4-(cyclopropylsulfonylamino)phenyl]methyl]carbamate.
| Compound Name | 4-(6-amino-2-chloropurin-9-yl)butyl N-[[4-(cyclopropylsulfonylamino)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 138609662 |
| Molecular Formula | C20H24ClN7O4S |
| Molecular Weight | 493.98 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 4-(6-amino-2-chloropurin-9-yl)butyl N-[[4-(cyclopropylsulfonylamino)phenyl]methyl]carbamate |
| SMILES | Nc1nc(Cl)nc2c1ncn2CCCCOC(=O)NCc1ccc(NS(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C20H24ClN7O4S/c21-19-25-17(22)16-18(26-19)28(12-24-16)9-1-2-10-32-20(29)23-11-13-3-5-14(6-4-13)27-33(30,31)15-7-8-15/h3-6,12,15,27H,1-2,7-11H2,(H,23,29)(H2,22,25,26) |
| InChIKey | HFJJICFLPOVEMR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 154.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.98 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|