C25H24ClN7O2 — CID 158847938
4-(2-chloro-6-methylpurin-9-yl)butyl N-[(2-phenylimidazo[1,2-a]pyridin-6-yl)methyl]carbamate (PubChem CID 158847938) has the molecular formula C25H24ClN7O2 and a molecular weight of 489.97 g/mol. Its IUPAC name is 4-(2-chloro-6-methylpurin-9-yl)butyl N-[(2-phenylimidazo[1,2-a]pyridin-6-yl)methyl]carbamate.
| Compound Name | 4-(2-chloro-6-methylpurin-9-yl)butyl N-[(2-phenylimidazo[1,2-a]pyridin-6-yl)methyl]carbamate |
|---|---|
| PubChem CID | 158847938 |
| Molecular Formula | C25H24ClN7O2 |
| Molecular Weight | 489.97 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 4-(2-chloro-6-methylpurin-9-yl)butyl N-[(2-phenylimidazo[1,2-a]pyridin-6-yl)methyl]carbamate |
| SMILES | Cc1nc(Cl)nc2c1ncn2CCCCOC(=O)NCc1ccc2nc(-c3ccccc3)cn2c1 |
| InChI | InChI=1S/C25H24ClN7O2/c1-17-22-23(31-24(26)29-17)32(16-28-22)11-5-6-12-35-25(34)27-13-18-9-10-21-30-20(15-33(21)14-18)19-7-3-2-4-8-19/h2-4,7-10,14-16H,5-6,11-13H2,1H3,(H,27,34) |
| InChIKey | QZTDHZPVAUDHIP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.97 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|