C20H22ClN7O4S — CID 138611615
4-(6-amino-2-chloropurin-9-yl)butyl N-[(1-methylsulfonylindol-5-yl)methyl]carbamate (PubChem CID 138611615) has the molecular formula C20H22ClN7O4S and a molecular weight of 491.96 g/mol. Its IUPAC name is 4-(6-amino-2-chloropurin-9-yl)butyl N-[(1-methylsulfonylindol-5-yl)methyl]carbamate.
| Compound Name | 4-(6-amino-2-chloropurin-9-yl)butyl N-[(1-methylsulfonylindol-5-yl)methyl]carbamate |
|---|---|
| PubChem CID | 138611615 |
| Molecular Formula | C20H22ClN7O4S |
| Molecular Weight | 491.96 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 4-(6-amino-2-chloropurin-9-yl)butyl N-[(1-methylsulfonylindol-5-yl)methyl]carbamate |
| SMILES | CS(=O)(=O)n1ccc2cc(CNC(=O)OCCCCn3cnc4c(N)nc(Cl)nc43)ccc21 |
| InChI | InChI=1S/C20H22ClN7O4S/c1-33(30,31)28-8-6-14-10-13(4-5-15(14)28)11-23-20(29)32-9-3-2-7-27-12-24-16-17(22)25-19(21)26-18(16)27/h4-6,8,10,12H,2-3,7,9,11H2,1H3,(H,23,29)(H2,22,25,26) |
| InChIKey | SBQQEHDHIKDBNL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 147.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.96 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|