C28H35N7O5S — CID 138610861
4-(6-amino-2-propoxypurin-9-yl)butyl N-[[4-[(4-methylphenyl)methylsulfamoyl]phenyl]methyl]carbamate (PubChem CID 138610861) has the molecular formula C28H35N7O5S and a molecular weight of 581.70 g/mol. Its IUPAC name is 4-(6-amino-2-propoxypurin-9-yl)butyl N-[[4-[(4-methylphenyl)methylsulfamoyl]phenyl]methyl]carbamate.
| Compound Name | 4-(6-amino-2-propoxypurin-9-yl)butyl N-[[4-[(4-methylphenyl)methylsulfamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 138610861 |
| Molecular Formula | C28H35N7O5S |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 4-(6-amino-2-propoxypurin-9-yl)butyl N-[[4-[(4-methylphenyl)methylsulfamoyl]phenyl]methyl]carbamate |
| SMILES | CCCOc1nc(N)c2ncn(CCCCOC(=O)NCc3ccc(S(=O)(=O)NCc4ccc(C)cc4)cc3)c2n1 |
| InChI | InChI=1S/C28H35N7O5S/c1-3-15-39-27-33-25(29)24-26(34-27)35(19-31-24)14-4-5-16-40-28(36)30-17-21-10-12-23(13-11-21)41(37,38)32-18-22-8-6-20(2)7-9-22/h6-13,19,32H,3-5,14-18H2,1-2H3,(H,30,36)(H2,29,33,34) |
| InChIKey | BHDKVNMZOSZAHS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 163.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|