C23H22F3N7O2 — CID 138611751
4-(6-amino-2-pyridin-4-ylpurin-9-yl)butyl N-[[3-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 138611751) has the molecular formula C23H22F3N7O2 and a molecular weight of 485.47 g/mol. Its IUPAC name is 4-(6-amino-2-pyridin-4-ylpurin-9-yl)butyl N-[[3-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | 4-(6-amino-2-pyridin-4-ylpurin-9-yl)butyl N-[[3-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 138611751 |
| Molecular Formula | C23H22F3N7O2 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 4-(6-amino-2-pyridin-4-ylpurin-9-yl)butyl N-[[3-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | Nc1nc(-c2ccncc2)nc2c1ncn2CCCCOC(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H22F3N7O2/c24-23(25,26)17-5-3-4-15(12-17)13-29-22(34)35-11-2-1-10-33-14-30-18-19(27)31-20(32-21(18)33)16-6-8-28-9-7-16/h3-9,12,14H,1-2,10-11,13H2,(H,29,34)(H2,27,31,32) |
| InChIKey | HCVBTWZIBPDHFN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|