C20H24ClFN6O2 — CID 170198156
4-(6-amino-2-chloropurin-9-yl)butyl N-[[4-(2-fluoropropan-2-yl)phenyl]methyl]carbamate (PubChem CID 170198156) has the molecular formula C20H24ClFN6O2 and a molecular weight of 434.90 g/mol. Its IUPAC name is 4-(6-amino-2-chloropurin-9-yl)butyl N-[[4-(2-fluoropropan-2-yl)phenyl]methyl]carbamate.
| Compound Name | 4-(6-amino-2-chloropurin-9-yl)butyl N-[[4-(2-fluoropropan-2-yl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 170198156 |
| Molecular Formula | C20H24ClFN6O2 |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 4-(6-amino-2-chloropurin-9-yl)butyl N-[[4-(2-fluoropropan-2-yl)phenyl]methyl]carbamate |
| SMILES | CC(C)(F)c1ccc(CNC(=O)OCCCCn2cnc3c(N)nc(Cl)nc32)cc1 |
| InChI | InChI=1S/C20H24ClFN6O2/c1-20(2,22)14-7-5-13(6-8-14)11-24-19(29)30-10-4-3-9-28-12-25-15-16(23)26-18(21)27-17(15)28/h5-8,12H,3-4,9-11H2,1-2H3,(H,24,29)(H2,23,26,27) |
| InChIKey | BUSZJRSVYWCUJQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|