C22H31ClFN5O2 — CID 174111986
4-[4-[N'-(1-chloroethyl)carbamimidoyl]-5-methylimidazol-1-yl]butyl N-[[4-(2-fluoropropan-2-yl)phenyl]methyl]carbamate (PubChem CID 174111986) has the molecular formula C22H31ClFN5O2 and a molecular weight of 451.97 g/mol. Its IUPAC name is 4-[4-[N'-(1-chloroethyl)carbamimidoyl]-5-methylimidazol-1-yl]butyl N-[[4-(2-fluoropropan-2-yl)phenyl]methyl]carbamate.
| Compound Name | 4-[4-[N'-(1-chloroethyl)carbamimidoyl]-5-methylimidazol-1-yl]butyl N-[[4-(2-fluoropropan-2-yl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 174111986 |
| Molecular Formula | C22H31ClFN5O2 |
| Molecular Weight | 451.97 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 4-[4-[N'-(1-chloroethyl)carbamimidoyl]-5-methylimidazol-1-yl]butyl N-[[4-(2-fluoropropan-2-yl)phenyl]methyl]carbamate |
| SMILES | Cc1c(C(N)=NC(C)Cl)ncn1CCCCOC(=O)NCc1ccc(C(C)(C)F)cc1 |
| InChI | InChI=1S/C22H31ClFN5O2/c1-15-19(20(25)28-16(2)23)27-14-29(15)11-5-6-12-31-21(30)26-13-17-7-9-18(10-8-17)22(3,4)24/h7-10,14,16H,5-6,11-13H2,1-4H3,(H2,25,28)(H,26,30) |
| InChIKey | ZDRZJGFEXGXNTL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.97 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|