C27H32ClN7O5S — CID 138611466
4-(6-amino-2-propan-2-yloxypurin-9-yl)butyl N-[[4-[(4-chlorophenyl)methylsulfamoyl]phenyl]methyl]carbamate (PubChem CID 138611466) has the molecular formula C27H32ClN7O5S and a molecular weight of 602.12 g/mol. Its IUPAC name is 4-(6-amino-2-propan-2-yloxypurin-9-yl)butyl N-[[4-[(4-chlorophenyl)methylsulfamoyl]phenyl]methyl]carbamate.
| Compound Name | 4-(6-amino-2-propan-2-yloxypurin-9-yl)butyl N-[[4-[(4-chlorophenyl)methylsulfamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 138611466 |
| Molecular Formula | C27H32ClN7O5S |
| Molecular Weight | 602.12 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | 4-(6-amino-2-propan-2-yloxypurin-9-yl)butyl N-[[4-[(4-chlorophenyl)methylsulfamoyl]phenyl]methyl]carbamate |
| SMILES | CC(C)Oc1nc(N)c2ncn(CCCCOC(=O)NCc3ccc(S(=O)(=O)NCc4ccc(Cl)cc4)cc3)c2n1 |
| InChI | InChI=1S/C27H32ClN7O5S/c1-18(2)40-26-33-24(29)23-25(34-26)35(17-31-23)13-3-4-14-39-27(36)30-15-19-7-11-22(12-8-19)41(37,38)32-16-20-5-9-21(28)10-6-20/h5-12,17-18,32H,3-4,13-16H2,1-2H3,(H,30,36)(H2,29,33,34) |
| InChIKey | OQRPXYNTNFAGRY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 163.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.12 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|