C20H21ClN6O2 — CID 157171938
4-(6-amino-2-chloropurin-9-yl)butyl N-(3H-inden-5-ylmethyl)carbamate (PubChem CID 157171938) has the molecular formula C20H21ClN6O2 and a molecular weight of 412.88 g/mol. Its IUPAC name is 4-(6-amino-2-chloropurin-9-yl)butyl N-(3H-inden-5-ylmethyl)carbamate.
| Compound Name | 4-(6-amino-2-chloropurin-9-yl)butyl N-(3H-inden-5-ylmethyl)carbamate |
|---|---|
| PubChem CID | 157171938 |
| Molecular Formula | C20H21ClN6O2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 4-(6-amino-2-chloropurin-9-yl)butyl N-(3H-inden-5-ylmethyl)carbamate |
| SMILES | Nc1nc(Cl)nc2c1ncn2CCCCOC(=O)NCc1ccc2c(c1)CC=C2 |
| InChI | InChI=1S/C20H21ClN6O2/c21-19-25-17(22)16-18(26-19)27(12-24-16)8-1-2-9-29-20(28)23-11-13-6-7-14-4-3-5-15(14)10-13/h3-4,6-7,10,12H,1-2,5,8-9,11H2,(H,23,28)(H2,22,25,26) |
| InChIKey | CCIRXLOJRZUIEH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|