C19H19ClF4N6O2 — CID 170198231
4-(6-amino-2-fluoropurin-9-yl)butyl N-[[2-chloro-3-methyl-6-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 170198231) has the molecular formula C19H19ClF4N6O2 and a molecular weight of 474.85 g/mol. Its IUPAC name is 4-(6-amino-2-fluoropurin-9-yl)butyl N-[[2-chloro-3-methyl-6-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | 4-(6-amino-2-fluoropurin-9-yl)butyl N-[[2-chloro-3-methyl-6-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 170198231 |
| Molecular Formula | C19H19ClF4N6O2 |
| Molecular Weight | 474.85 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 4-(6-amino-2-fluoropurin-9-yl)butyl N-[[2-chloro-3-methyl-6-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | Cc1ccc(C(F)(F)F)c(CNC(=O)OCCCCn2cnc3c(N)nc(F)nc32)c1Cl |
| InChI | InChI=1S/C19H19ClF4N6O2/c1-10-4-5-12(19(22,23)24)11(13(10)20)8-26-18(31)32-7-3-2-6-30-9-27-14-15(25)28-17(21)29-16(14)30/h4-5,9H,2-3,6-8H2,1H3,(H,26,31)(H2,25,28,29) |
| InChIKey | ZYFOCANRNKCKND-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.85 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|