C24H25FN6O — CID 145395697
2-fluoro-9-[4-[1-[(3-phenylphenyl)methylamino]ethenoxy]butyl]purin-6-amine (PubChem CID 145395697) has the molecular formula C24H25FN6O and a molecular weight of 432.50 g/mol. Its IUPAC name is 2-fluoro-9-[4-[1-[(3-phenylphenyl)methylamino]ethenoxy]butyl]purin-6-amine.
| Compound Name | 2-fluoro-9-[4-[1-[(3-phenylphenyl)methylamino]ethenoxy]butyl]purin-6-amine |
|---|---|
| PubChem CID | 145395697 |
| Molecular Formula | C24H25FN6O |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 2-fluoro-9-[4-[1-[(3-phenylphenyl)methylamino]ethenoxy]butyl]purin-6-amine |
| SMILES | C=C(NCc1cccc(-c2ccccc2)c1)OCCCCn1cnc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C24H25FN6O/c1-17(27-15-18-8-7-11-20(14-18)19-9-3-2-4-10-19)32-13-6-5-12-31-16-28-21-22(26)29-24(25)30-23(21)31/h2-4,7-11,14,16,27H,1,5-6,12-13,15H2,(H2,26,29,30) |
| InChIKey | UIGCZSPNKCDEAR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|