About 9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine
9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine (PubChem CID 145395691) has the molecular formula C20H23N7O2
and a molecular weight of 393.45 g/mol. Its IUPAC name is 9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine.
Molecular Properties
| Compound Name | 9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine |
| PubChem CID | 145395691 |
| Molecular Formula | C20H23N7O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine |
| SMILES | C=C(NCc1ccc2ncoc2c1)OCCCCn1cnc2c(N)nc(C)nc21 |
| InChI | InChI=1S/C20H23N7O2/c1-13-25-19(21)18-20(26-13)27(11-23-18)7-3-4-8-28-14(2)22-10-15-5-6-16-17(9-15)29-12-24-16/h5-6,9,11-12,22H,2-4,7-8,10H2,1H3,(H2,21,25,26) |
| InChIKey | POKGUUZTZCMXNO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine?
The IUPAC name of 9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine (CID 145395691) is 9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine.
What is the SMILES notation for 9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine?
The canonical SMILES for 9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine is C=C(NCc1ccc2ncoc2c1)OCCCCn1cnc2c(N)nc(C)nc21.
What is the InChIKey of 9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine?
The InChIKey is POKGUUZTZCMXNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N7O2/c1-13-25-19(21)18-20(26-13)27(11-23-18)7-3-4-8-28-14(2)22-10-15-5-6-16-17(9-15)29-12-24-16/h5-6,9,11-12,22H,2-4,7-8,10H2,1H3,(H2,21,25,26).
What are the key properties of 9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine?
9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine has a molecular weight of 393.45 g/mol, XLogP of 2.92, 9 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[4-[1-(1,3-benzoxazol-6-ylmethylamino)ethenoxy]butyl]-2-methylpurin-6-amine is sourced from PubChem (CID 145395691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).