C28H33N7O4S — CID 138611646
4-[6-amino-2-[(Z)-prop-1-enyl]purin-9-yl]butyl N-[[4-[(4-methylphenyl)methylsulfamoyl]phenyl]methyl]carbamate (PubChem CID 138611646) has the molecular formula C28H33N7O4S and a molecular weight of 563.68 g/mol. Its IUPAC name is 4-[6-amino-2-[(Z)-prop-1-enyl]purin-9-yl]butyl N-[[4-[(4-methylphenyl)methylsulfamoyl]phenyl]methyl]carbamate.
| Compound Name | 4-[6-amino-2-[(Z)-prop-1-enyl]purin-9-yl]butyl N-[[4-[(4-methylphenyl)methylsulfamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 138611646 |
| Molecular Formula | C28H33N7O4S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 4-[6-amino-2-[(Z)-prop-1-enyl]purin-9-yl]butyl N-[[4-[(4-methylphenyl)methylsulfamoyl]phenyl]methyl]carbamate |
| SMILES | C/C=C\c1nc(N)c2ncn(CCCCOC(=O)NCc3ccc(S(=O)(=O)NCc4ccc(C)cc4)cc3)c2n1 |
| InChI | InChI=1S/C28H33N7O4S/c1-3-6-24-33-26(29)25-27(34-24)35(19-31-25)15-4-5-16-39-28(36)30-17-21-11-13-23(14-12-21)40(37,38)32-18-22-9-7-20(2)8-10-22/h3,6-14,19,32H,4-5,15-18H2,1-2H3,(H,30,36)(H2,29,33,34)/b6-3- |
| InChIKey | PPIFLWWRRYJRFM-UTCJRWHESA-N |
| XLogP | 3.94 |
| TPSA | 154.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|