C26H31FN6O — CID 170201590
9-[6-[[3-(2-fluoropropan-2-yl)phenyl]methylamino]hept-6-enyl]-2-(furan-3-yl)purin-6-amine (PubChem CID 170201590) has the molecular formula C26H31FN6O and a molecular weight of 462.57 g/mol. Its IUPAC name is 9-[6-[[3-(2-fluoropropan-2-yl)phenyl]methylamino]hept-6-enyl]-2-(furan-3-yl)purin-6-amine.
| Compound Name | 9-[6-[[3-(2-fluoropropan-2-yl)phenyl]methylamino]hept-6-enyl]-2-(furan-3-yl)purin-6-amine |
|---|---|
| PubChem CID | 170201590 |
| Molecular Formula | C26H31FN6O |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 9-[6-[[3-(2-fluoropropan-2-yl)phenyl]methylamino]hept-6-enyl]-2-(furan-3-yl)purin-6-amine |
| SMILES | C=C(CCCCCn1cnc2c(N)nc(-c3ccoc3)nc21)NCc1cccc(C(C)(C)F)c1 |
| InChI | InChI=1S/C26H31FN6O/c1-18(29-15-19-9-7-10-21(14-19)26(2,3)27)8-5-4-6-12-33-17-30-22-23(28)31-24(32-25(22)33)20-11-13-34-16-20/h7,9-11,13-14,16-17,29H,1,4-6,8,12,15H2,2-3H3,(H2,28,31,32) |
| InChIKey | RGTRKSMTFBNFHV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|