C18H22N2O5S — CID 17383331
ethyl N-[[4-(2-phenoxyethylsulfamoyl)phenyl]methyl]carbamate (PubChem CID 17383331) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is ethyl N-[[4-(2-phenoxyethylsulfamoyl)phenyl]methyl]carbamate.
| Compound Name | ethyl N-[[4-(2-phenoxyethylsulfamoyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 17383331 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | ethyl N-[[4-(2-phenoxyethylsulfamoyl)phenyl]methyl]carbamate |
| SMILES | CCOC(=O)NCc1ccc(S(=O)(=O)NCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C18H22N2O5S/c1-2-24-18(21)19-14-15-8-10-17(11-9-15)26(22,23)20-12-13-25-16-6-4-3-5-7-16/h3-11,20H,2,12-14H2,1H3,(H,19,21) |
| InChIKey | HQPABRMWJBNMGW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|