C25H20N8O2 — CID 118420935
N-[3-[6-amino-2-(4-pyridin-3-yloxyanilino)purin-9-yl]phenyl]prop-2-enamide (PubChem CID 118420935) has the molecular formula C25H20N8O2 and a molecular weight of 464.49 g/mol. Its IUPAC name is N-[3-[6-amino-2-(4-pyridin-3-yloxyanilino)purin-9-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[6-amino-2-(4-pyridin-3-yloxyanilino)purin-9-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118420935 |
| Molecular Formula | C25H20N8O2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-[3-[6-amino-2-(4-pyridin-3-yloxyanilino)purin-9-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2cnc3c(N)nc(Nc4ccc(Oc5cccnc5)cc4)nc32)c1 |
| InChI | InChI=1S/C25H20N8O2/c1-2-21(34)29-17-5-3-6-18(13-17)33-15-28-22-23(26)31-25(32-24(22)33)30-16-8-10-19(11-9-16)35-20-7-4-12-27-14-20/h2-15H,1H2,(H,29,34)(H3,26,30,31,32) |
| InChIKey | VFVRVQQNRDRRKN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 132.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|