C20H18ClN7O3S — CID 118421069
N-[3-[6-amino-2-(4-methylsulfonylanilino)purin-9-yl]phenyl]-2-chloroacetamide (PubChem CID 118421069) has the molecular formula C20H18ClN7O3S and a molecular weight of 471.93 g/mol. Its IUPAC name is N-[3-[6-amino-2-(4-methylsulfonylanilino)purin-9-yl]phenyl]-2-chloroacetamide.
| Compound Name | N-[3-[6-amino-2-(4-methylsulfonylanilino)purin-9-yl]phenyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 118421069 |
| Molecular Formula | C20H18ClN7O3S |
| Molecular Weight | 471.93 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | N-[3-[6-amino-2-(4-methylsulfonylanilino)purin-9-yl]phenyl]-2-chloroacetamide |
| SMILES | CS(=O)(=O)c1ccc(Nc2nc(N)c3ncn(-c4cccc(NC(=O)CCl)c4)c3n2)cc1 |
| InChI | InChI=1S/C20H18ClN7O3S/c1-32(30,31)15-7-5-12(6-8-15)25-20-26-18(22)17-19(27-20)28(11-23-17)14-4-2-3-13(9-14)24-16(29)10-21/h2-9,11H,10H2,1H3,(H,24,29)(H3,22,25,26,27) |
| InChIKey | YLMBDANYZKSKEO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 144.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.93 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|