C19H22N6O3S — CID 166628711
4-(6-aminopurin-9-yl)-N-(3-methylsulfonylphenyl)cyclohexane-1-carboxamide (PubChem CID 166628711) has the molecular formula C19H22N6O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is 4-(6-aminopurin-9-yl)-N-(3-methylsulfonylphenyl)cyclohexane-1-carboxamide.
| Compound Name | 4-(6-aminopurin-9-yl)-N-(3-methylsulfonylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166628711 |
| Molecular Formula | C19H22N6O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 4-(6-aminopurin-9-yl)-N-(3-methylsulfonylphenyl)cyclohexane-1-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)C2CCC(n3cnc4c(N)ncnc43)CC2)c1 |
| InChI | InChI=1S/C19H22N6O3S/c1-29(27,28)15-4-2-3-13(9-15)24-19(26)12-5-7-14(8-6-12)25-11-23-16-17(20)21-10-22-18(16)25/h2-4,9-12,14H,5-8H2,1H3,(H,24,26)(H2,20,21,22) |
| InChIKey | ZBSYEZYIXGWFPE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |