C26H27N7O3 — CID 134214697
3-[6-amino-9-[4-[(3-methoxyphenyl)carbamoyl]cyclohexyl]purin-2-yl]benzamide (PubChem CID 134214697) has the molecular formula C26H27N7O3 and a molecular weight of 485.55 g/mol. Its IUPAC name is 3-[6-amino-9-[4-[(3-methoxyphenyl)carbamoyl]cyclohexyl]purin-2-yl]benzamide.
| Compound Name | 3-[6-amino-9-[4-[(3-methoxyphenyl)carbamoyl]cyclohexyl]purin-2-yl]benzamide |
|---|---|
| PubChem CID | 134214697 |
| Molecular Formula | C26H27N7O3 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 3-[6-amino-9-[4-[(3-methoxyphenyl)carbamoyl]cyclohexyl]purin-2-yl]benzamide |
| SMILES | COc1cccc(NC(=O)C2CCC(n3cnc4c(N)nc(-c5cccc(C(N)=O)c5)nc43)CC2)c1 |
| InChI | InChI=1S/C26H27N7O3/c1-36-20-7-3-6-18(13-20)30-26(35)15-8-10-19(11-9-15)33-14-29-21-22(27)31-24(32-25(21)33)17-5-2-4-16(12-17)23(28)34/h2-7,12-15,19H,8-11H2,1H3,(H2,28,34)(H,30,35)(H2,27,31,32) |
| InChIKey | HSCVAFOCWCEHKC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 151.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |