C21H22N6O2 — CID 134209823
1-(6-amino-2-ethynylpurin-9-yl)-N-(3-methoxyphenyl)cyclohexane-1-carboxamide (PubChem CID 134209823) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 1-(6-amino-2-ethynylpurin-9-yl)-N-(3-methoxyphenyl)cyclohexane-1-carboxamide.
| Compound Name | 1-(6-amino-2-ethynylpurin-9-yl)-N-(3-methoxyphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 134209823 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-(6-amino-2-ethynylpurin-9-yl)-N-(3-methoxyphenyl)cyclohexane-1-carboxamide |
| SMILES | C#Cc1nc(N)c2ncn(C3(C(=O)Nc4cccc(OC)c4)CCCCC3)c2n1 |
| InChI | InChI=1S/C21H22N6O2/c1-3-16-25-18(22)17-19(26-16)27(13-23-17)21(10-5-4-6-11-21)20(28)24-14-8-7-9-15(12-14)29-2/h1,7-9,12-13H,4-6,10-11H2,2H3,(H,24,28)(H2,22,25,26) |
| InChIKey | ZPZUSCCPDVIJAV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|