C19H21NO2 — CID 1455676
N-(3-methoxyphenyl)-1-phenylcyclopentane-1-carboxamide (PubChem CID 1455676) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-1-phenylcyclopentane-1-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-1-phenylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 1455676 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-(3-methoxyphenyl)-1-phenylcyclopentane-1-carboxamide |
| SMILES | COc1cccc(NC(=O)C2(c3ccccc3)CCCC2)c1 |
| InChI | InChI=1S/C19H21NO2/c1-22-17-11-7-10-16(14-17)20-18(21)19(12-5-6-13-19)15-8-3-2-4-9-15/h2-4,7-11,14H,5-6,12-13H2,1H3,(H,20,21) |
| InChIKey | HMCVAQJPCPDOAO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |