C18H19NO2S — CID 95619879
N-[3-[(R)-methylsulfinyl]phenyl]-1-phenylcyclobutane-1-carboxamide (PubChem CID 95619879) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is N-[3-[(R)-methylsulfinyl]phenyl]-1-phenylcyclobutane-1-carboxamide.
| Compound Name | N-[3-[(R)-methylsulfinyl]phenyl]-1-phenylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 95619879 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-[3-[(R)-methylsulfinyl]phenyl]-1-phenylcyclobutane-1-carboxamide |
| SMILES | C[S@@](=O)c1cccc(NC(=O)C2(c3ccccc3)CCC2)c1 |
| InChI | InChI=1S/C18H19NO2S/c1-22(21)16-10-5-9-15(13-16)19-17(20)18(11-6-12-18)14-7-3-2-4-8-14/h2-5,7-10,13H,6,11-12H2,1H3,(H,19,20)/t22-/m1/s1 |
| InChIKey | WSAGWXWRZCKQCO-JOCHJYFZSA-N |
| XLogP | 3.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |