C25H25F2N9O — CID 118420633
N-[5-[6-amino-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]-2-fluorophenyl]prop-2-enamide (PubChem CID 118420633) has the molecular formula C25H25F2N9O and a molecular weight of 505.53 g/mol. Its IUPAC name is N-[5-[6-amino-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]-2-fluorophenyl]prop-2-enamide.
| Compound Name | N-[5-[6-amino-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]-2-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118420633 |
| Molecular Formula | C25H25F2N9O |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | N-[5-[6-amino-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]-2-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-n2cnc3c(N)nc(Nc4ccc(N5CCN(C)CC5)c(F)c4)nc32)ccc1F |
| InChI | InChI=1S/C25H25F2N9O/c1-3-21(37)31-19-13-16(5-6-17(19)26)36-14-29-22-23(28)32-25(33-24(22)36)30-15-4-7-20(18(27)12-15)35-10-8-34(2)9-11-35/h3-7,12-14H,1,8-11H2,2H3,(H,31,37)(H3,28,30,32,33) |
| InChIKey | LMODBJJEGWSYKM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|