C28H25N5O3 — CID 89432607
2-(3-methoxyanilino)-N-phenyl-4-[[3-(prop-2-enoylamino)phenyl]methyl]pyrimidine-5-carboxamide (PubChem CID 89432607) has the molecular formula C28H25N5O3 and a molecular weight of 479.54 g/mol. Its IUPAC name is 2-(3-methoxyanilino)-N-phenyl-4-[[3-(prop-2-enoylamino)phenyl]methyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(3-methoxyanilino)-N-phenyl-4-[[3-(prop-2-enoylamino)phenyl]methyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 89432607 |
| Molecular Formula | C28H25N5O3 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 2-(3-methoxyanilino)-N-phenyl-4-[[3-(prop-2-enoylamino)phenyl]methyl]pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(Cc2nc(Nc3cccc(OC)c3)ncc2C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C28H25N5O3/c1-3-26(34)30-21-12-7-9-19(15-21)16-25-24(27(35)31-20-10-5-4-6-11-20)18-29-28(33-25)32-22-13-8-14-23(17-22)36-2/h3-15,17-18H,1,16H2,2H3,(H,30,34)(H,31,35)(H,29,32,33) |
| InChIKey | LCPCIWPRZJNYPL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|