C27H27N5O3 — CID 89434811
4-[(3-aminophenyl)methyl]-2-(3-methoxyanilino)-N-[(4-methoxyphenyl)methyl]pyrimidine-5-carboxamide (PubChem CID 89434811) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is 4-[(3-aminophenyl)methyl]-2-(3-methoxyanilino)-N-[(4-methoxyphenyl)methyl]pyrimidine-5-carboxamide.
| Compound Name | 4-[(3-aminophenyl)methyl]-2-(3-methoxyanilino)-N-[(4-methoxyphenyl)methyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 89434811 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 4-[(3-aminophenyl)methyl]-2-(3-methoxyanilino)-N-[(4-methoxyphenyl)methyl]pyrimidine-5-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cnc(Nc3cccc(OC)c3)nc2Cc2cccc(N)c2)cc1 |
| InChI | InChI=1S/C27H27N5O3/c1-34-22-11-9-18(10-12-22)16-29-26(33)24-17-30-27(31-21-7-4-8-23(15-21)35-2)32-25(24)14-19-5-3-6-20(28)13-19/h3-13,15,17H,14,16,28H2,1-2H3,(H,29,33)(H,30,31,32) |
| InChIKey | UNIRKPCIIRDYNN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|