C20H18FN3O2 — CID 109190439
5-(3-fluoroanilino)-N-[(4-methoxyphenyl)methyl]pyridine-2-carboxamide (PubChem CID 109190439) has the molecular formula C20H18FN3O2 and a molecular weight of 351.38 g/mol. Its IUPAC name is 5-(3-fluoroanilino)-N-[(4-methoxyphenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 5-(3-fluoroanilino)-N-[(4-methoxyphenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109190439 |
| Molecular Formula | C20H18FN3O2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 5-(3-fluoroanilino)-N-[(4-methoxyphenyl)methyl]pyridine-2-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(Nc3cccc(F)c3)cn2)cc1 |
| InChI | InChI=1S/C20H18FN3O2/c1-26-18-8-5-14(6-9-18)12-23-20(25)19-10-7-17(13-22-19)24-16-4-2-3-15(21)11-16/h2-11,13,24H,12H2,1H3,(H,23,25) |
| InChIKey | ZLLWUXMJLUJFMM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |