C20H17F2N3O2 — CID 109190451
5-(3,4-difluoroanilino)-N-[(4-methoxyphenyl)methyl]pyridine-2-carboxamide (PubChem CID 109190451) has the molecular formula C20H17F2N3O2 and a molecular weight of 369.37 g/mol. Its IUPAC name is 5-(3,4-difluoroanilino)-N-[(4-methoxyphenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 5-(3,4-difluoroanilino)-N-[(4-methoxyphenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109190451 |
| Molecular Formula | C20H17F2N3O2 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 5-(3,4-difluoroanilino)-N-[(4-methoxyphenyl)methyl]pyridine-2-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(Nc3ccc(F)c(F)c3)cn2)cc1 |
| InChI | InChI=1S/C20H17F2N3O2/c1-27-16-6-2-13(3-7-16)11-24-20(26)19-9-5-15(12-23-19)25-14-4-8-17(21)18(22)10-14/h2-10,12,25H,11H2,1H3,(H,24,26) |
| InChIKey | KTTRZINRXHPGQF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |