C21H19F2N3O2 — CID 109192661
5-(3,4-difluoroanilino)-N-[2-(3-methoxyphenyl)ethyl]pyridine-2-carboxamide (PubChem CID 109192661) has the molecular formula C21H19F2N3O2 and a molecular weight of 383.40 g/mol. Its IUPAC name is 5-(3,4-difluoroanilino)-N-[2-(3-methoxyphenyl)ethyl]pyridine-2-carboxamide.
| Compound Name | 5-(3,4-difluoroanilino)-N-[2-(3-methoxyphenyl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109192661 |
| Molecular Formula | C21H19F2N3O2 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 5-(3,4-difluoroanilino)-N-[2-(3-methoxyphenyl)ethyl]pyridine-2-carboxamide |
| SMILES | COc1cccc(CCNC(=O)c2ccc(Nc3ccc(F)c(F)c3)cn2)c1 |
| InChI | InChI=1S/C21H19F2N3O2/c1-28-17-4-2-3-14(11-17)9-10-24-21(27)20-8-6-16(13-25-20)26-15-5-7-18(22)19(23)12-15/h2-8,11-13,26H,9-10H2,1H3,(H,24,27) |
| InChIKey | XDRZSHFTLKBPKE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |