C19H29FN2 — CID 59295552
1-(4-tert-butyl-2-fluorophenyl)-4-pyrrolidin-1-ylpiperidine (PubChem CID 59295552) has the molecular formula C19H29FN2 and a molecular weight of 304.45 g/mol. Its IUPAC name is 1-(4-tert-butyl-2-fluorophenyl)-4-pyrrolidin-1-ylpiperidine.
| Compound Name | 1-(4-tert-butyl-2-fluorophenyl)-4-pyrrolidin-1-ylpiperidine |
|---|---|
| PubChem CID | 59295552 |
| Molecular Formula | C19H29FN2 |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 1-(4-tert-butyl-2-fluorophenyl)-4-pyrrolidin-1-ylpiperidine |
| SMILES | CC(C)(C)c1ccc(N2CCC(N3CCCC3)CC2)c(F)c1 |
| InChI | InChI=1S/C19H29FN2/c1-19(2,3)15-6-7-18(17(20)14-15)22-12-8-16(9-13-22)21-10-4-5-11-21/h6-7,14,16H,4-5,8-13H2,1-3H3 |
| InChIKey | RCILDMLIVONSMV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |